
CAS 1220019-27-1
:Piperidine, 4-[(2-bromo-4-fluorophenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-bromo-4-fluorophenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2-bromo-4-fluorophenoxy group attached to the piperidine ring, indicating the presence of a bromine and a fluorine substituent on the aromatic ring, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of halogen atoms often suggests potential for interactions in biological systems, making this compound of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Safety data should be consulted to understand its handling and potential hazards, as halogenated compounds can exhibit varying degrees of toxicity.
Formula:C12H15BrFNO·ClH
InChI:InChI=1S/C12H15BrFNO.ClH/c13-11-7-10(14)1-2-12(11)16-8-9-3-5-15-6-4-9;/h1-2,7,9,15H,3-6,8H2;1H
InChI key:InChIKey=KTPIZXYCASXYDB-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C2=C(Br)C=C(F)C=C2.Cl
Synonyms:- Piperidine, 4-[(2-bromo-4-fluorophenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.