CAS 1220019-33-9

Propanamide, 2-amino-N-cyclopentyl-2-methyl-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-N-cyclopentyl-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. This compound features a cyclopentyl group and a methyl group attached to the nitrogen atom, contributing to its unique structural properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group indicates potential basicity, allowing it to participate in various chemical reactions, including those involving proton transfer. Its molecular structure suggests it may exhibit specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many amides, it may also engage in hydrogen bonding, affecting its physical properties and interactions with other molecules. Overall, this compound's characteristics make it a subject of interest for further research and application in drug development.

Formula: C₉H₁₈N₂O·ClH

InChI: InChI=1S/C9H18N2O.ClH/c1-9(2,10)8(12)11-7-5-3-4-6-7;/h7H,3-6,10H2,1-2H3,(H,11,12);1H

InChI key: InChIKey=VKYXQUUARFDTDP-UHFFFAOYSA-N

SMILES: C(C(C)(C)N)(NC1CCCC1)=O.Cl

Synonyms:

• Propanamide, 2-amino-N-cyclopentyl-2-methyl-, hydrochloride (1:1)