CAS 1220019-38-4

Propanamide, 3-amino-N-(2-methoxyethyl)-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-(2-methoxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the amino group suggests that it can participate in various biochemical interactions, making it relevant in pharmaceutical applications. The methoxyethyl substituent contributes to its solubility properties, enhancing its compatibility with organic solvents and possibly influencing its bioavailability. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, which is advantageous for formulation in drug development. The compound's molecular structure implies potential uses in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. Its CAS number, 1220019-38-4, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound's unique structural features position it as a candidate for further research in therapeutic applications.

Formula: C₆H₁₄N₂O₂·ClH

InChI: InChI=1S/C6H14N2O2.ClH/c1-10-5-4-8-6(9)2-3-7;/h2-5,7H2,1H3,(H,8,9);1H

InChI key: InChIKey=WRSVRXLGHKNPPR-UHFFFAOYSA-N

SMILES: N(C(CCN)=O)CCOC.Cl

Synonyms:

• Propanamide, 3-amino-N-(2-methoxyethyl)-, hydrochloride (1:1)

3-Amino-N-(2-methoxyethyl)propanamide hydrochloride

CAS: 1220019-38-4

Versatile small molecule scaffold

Formula: C₆H₁₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 182.65 g/mol

Ref: 3D-VYB01938