CAS 1220019-41-9

Isoquinoline, 1,2,3,4-tetrahydro-2-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)

Description:

Isoquinoline, 1,2,3,4-tetrahydro-2-(2-pyrrolidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core and a pyrrolidine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. The presence of the pyrrolidine group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may exhibit various pharmacological properties, including potential neuroactive effects, owing to its structural similarity to other biologically active isoquinoline derivatives. Its molecular interactions can be influenced by the stereochemistry of the tetrahydroisoquinoline and the substituents on the pyrrolidine ring. As with many isoquinoline derivatives, it may also display fluorescence properties, making it useful in analytical chemistry. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₄H₂₀N₂·2ClH

InChI: InChI=1S/C14H20N2.2ClH/c1-2-5-13-10-16(9-7-12(13)4-1)11-14-6-3-8-15-14;;/h1-2,4-5,14-15H,3,6-11H2;2*1H

InChI key: InChIKey=LXVLMVQZRQJTCH-UHFFFAOYSA-N

SMILES: C(N1CC=2C(CC1)=CC=CC2)C3CCCN3.Cl

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-2-(2-pyrrolidinylmethyl)-, hydrochloride (1:2)

2-[(Pyrrolidin-2-yl)methyl]-1,2,3,4-tetrahydroisoquinoline dihydrochloride

CAS: 1220019-41-9

Versatile small molecule scaffold

Formula: C₁₄H₂₂Cl₂N₂

Purity: Min. 95%

Molecular weight: 289.2 g/mol

Ref: 3D-VYB01941