CAS 1220019-42-0

Ethyl 3-amino-4-[(3-ethoxypropyl)amino]benzoate

Description:

Ethyl 3-amino-4-[(3-ethoxypropyl)amino]benzoate, identified by its CAS number 1220019-42-0, is an organic compound that features a benzoate structure with amino groups and an ethoxypropyl substituent. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of amino functional groups, which can enhance biological activity and solubility. The ethyl ester group contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including acylation and amination. Additionally, the compound's molecular structure may exhibit specific stereochemical configurations, impacting its interaction with biological targets. Overall, Ethyl 3-amino-4-[(3-ethoxypropyl)amino]benzoate represents a complex molecule with diverse chemical properties, making it of interest in both synthetic and applied chemistry contexts.

Formula: C₁₄H₂₂N₂O₃

InChI: InChI=1S/C14H22N2O3/c1-3-18-9-5-8-16-13-7-6-11(10-12(13)15)14(17)19-4-2/h6-7,10,16H,3-5,8-9,15H2,1-2H3

InChI key: InChIKey=PCKZWIYTJXTRIE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(N)=C(NCCCOCC)C=C1

Synonyms:

• Benzoic acid, 3-amino-4-[(3-ethoxypropyl)amino]-, ethyl ester
• Ethyl 3-amino-4-[(3-ethoxypropyl)amino]benzoate