
CAS 1220019-44-2
:Piperidine, 3-[2-([1,1′-biphenyl]-2-yloxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-([1,1′-biphenyl]-2-yloxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a biphenyl moiety, indicating the presence of two phenyl rings connected by a single bond, which contributes to its hydrophobic characteristics. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. This compound may exhibit biological activity due to the piperidine structure, which is often found in various alkaloids and pharmacologically active compounds. Its specific interactions and effects would depend on the substituents and the overall molecular structure. As with many piperidine derivatives, it may have potential uses in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C19H23NO·ClH
InChI:InChI=1S/C19H23NO.ClH/c1-2-8-17(9-3-1)18-10-4-5-11-19(18)21-14-12-16-7-6-13-20-15-16;/h1-5,8-11,16,20H,6-7,12-15H2;1H
InChI key:InChIKey=ADVSONFCQVKJTI-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=C(C=CC=C2)C3=CC=CC=C3.Cl
Synonyms:- Piperidine, 3-[2-([1,1′-biphenyl]-2-yloxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.