CAS 1220019-48-6

Pyrrolidine, 3-[(3-ethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(3-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a 3-ethylphenoxy group contributes to its unique properties, influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit biological activity due to its structural features, potentially interacting with biological targets. Its molecular structure suggests it could be involved in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, the characteristics of this compound make it of interest in medicinal chemistry and related fields, although specific applications and biological effects would require further investigation.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c1-2-11-4-3-5-13(8-11)15-10-12-6-7-14-9-12;/h3-5,8,12,14H,2,6-7,9-10H2,1H3;1H

InChI key: InChIKey=BWVVMUSUTRLYNN-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC(CC)=CC=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(3-ethylphenoxy)methyl]-, hydrochloride (1:1)