CAS 1220019-50-0

Piperidine, 4-(2-iodophenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 4-(2-iodophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2-iodophenoxy group, indicating the presence of an iodine atom attached to a phenyl ring that is further connected to the piperidine via an ether linkage. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various applications, particularly in medicinal chemistry and drug development. The presence of the iodine atom may impart unique biological properties, making it of interest in the synthesis of pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, and its hydrochloride form can influence its pharmacokinetic properties. Safety data and handling precautions should be observed, as with any chemical substance, particularly those containing halogens, which may pose toxicity risks.

Formula: C₁₁H₁₄INO·ClH

InChI: InChI=1S/C11H14INO.ClH/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9;/h1-4,9,13H,5-8H2;1H

InChI key: InChIKey=RHFSGYQETBHLFA-UHFFFAOYSA-N

SMILES: O(C1=C(I)C=CC=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(2-iodophenoxy)-, hydrochloride (1:1)