CAS 1220019-51-1

3-(2-Pyridinyl)-1H-indole-2-carboxylic acid

Description:

3-(2-Pyridinyl)-1H-indole-2-carboxylic acid, identified by its CAS number 1220019-51-1, is a chemical compound that features a complex structure combining an indole moiety with a pyridine ring. This compound typically exhibits properties characteristic of both heterocyclic aromatic compounds, including potential biological activity due to its structural components. It is likely to be a solid at room temperature, with moderate solubility in polar solvents, reflecting the presence of both carboxylic acid and nitrogen-containing heterocycles. The indole and pyridine rings contribute to its potential as a ligand in coordination chemistry or as a scaffold in medicinal chemistry, where it may exhibit pharmacological properties. The presence of the carboxylic acid group suggests it can participate in hydrogen bonding and may influence its reactivity and interaction with biological targets. Overall, this compound is of interest in research fields such as drug development and organic synthesis due to its unique structural features and potential applications.

Formula: C₁₄H₁₀N₂O₂

InChI: InChI=1S/C14H10N2O2/c17-14(18)13-12(11-7-3-4-8-15-11)9-5-1-2-6-10(9)16-13/h1-8,16H,(H,17,18)

InChI key: InChIKey=OPFPUKYSQYOGCI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=2C(N1)=CC=CC2)C3=CC=CC=N3

Synonyms:

• 1H-Indole-2-carboxylic acid, 3-(2-pyridinyl)-
• 3-(2-Pyridinyl)-1H-indole-2-carboxylic acid