CAS 1220019-53-3

Piperidine, 4-[[2-methyl-5-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[2-methyl-5-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenoxy group substituted with a branched alkyl chain, specifically a 2-methyl-5-(1-methylethyl)phenyl moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored for their roles in medicinal chemistry. The compound's structure may influence its pharmacokinetics, including absorption, distribution, metabolism, and excretion. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a specific class of organic molecules with potential applications in drug development and research.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-12(2)15-5-4-13(3)16(10-15)18-11-14-6-8-17-9-7-14;/h4-5,10,12,14,17H,6-9,11H2,1-3H3;1H

InChI key: InChIKey=KMWKWVOJEKJXGC-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=CC(C(C)C)=CC=C2C.Cl

Synonyms:

• Piperidine, 4-[[2-methyl-5-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)