
CAS 1220019-60-2
:1-(2-Methylpropyl)-3-piperidineacetic acid
Description:
1-(2-Methylpropyl)-3-piperidineacetic acid, identified by its CAS number 1220019-60-2, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a side chain with a 2-methylpropyl group and an acetic acid functional group, contributing to its potential biological activity. The presence of the piperidine moiety suggests that it may exhibit properties similar to other piperidine derivatives, which are often investigated for their pharmacological effects. The compound is likely to be a solid at room temperature and may be soluble in polar solvents due to the presence of the carboxylic acid group. Its molecular structure indicates potential interactions with biological targets, making it of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. Overall, this compound represents a unique structure that may have implications in drug development and other chemical applications.
Formula:C11H21NO2
InChI:InChI=1S/C11H21NO2/c1-9(2)7-12-5-3-4-10(8-12)6-11(13)14/h9-10H,3-8H2,1-2H3,(H,13,14)
InChI key:InChIKey=QWQPLFHJYSHPQB-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1CN(CC(C)C)CCC1
Synonyms:- 3-Piperidineacetic acid, 1-(2-methylpropyl)-
- 1-(2-Methylpropyl)-3-piperidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.