CymitQuimica logo

CAS 1220019-61-3

:

3-Piperidinamine, N-butyl-N-methyl-, hydrochloride (1:2)

Description:
3-Piperidinamine, N-butyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This substance features both butyl and methyl substituents on the nitrogen atom, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and chemical synthesis. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure may influence its interaction with biological targets, potentially affecting its efficacy and safety profile. Additionally, the hydrochloride form indicates that it may exhibit acidic properties, which can be relevant in formulation and stability considerations. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and related fields.
Formula:C10H22N2·2ClH
InChI:InChI=1S/C10H22N2.2ClH/c1-3-4-8-12(2)10-6-5-7-11-9-10;;/h10-11H,3-9H2,1-2H3;2*1H
InChI key:InChIKey=NACVUUDLHIHVAY-UHFFFAOYSA-N
SMILES:N(CCCC)(C)C1CCCNC1.Cl
Synonyms:
  • 3-Piperidinamine, N-butyl-N-methyl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.