CAS 1220019-64-6

1-(2-Methylpropyl)-3-pyrrolidineacetic acid

Description:

1-(2-Methylpropyl)-3-pyrrolidineacetic acid, identified by its CAS number 1220019-64-6, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and an acetic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the 2-methylpropyl group contributes to its hydrophobic characteristics, which may influence its biological activity and interactions with other molecules. As a derivative of pyrrolidine, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The compound's specific reactivity and stability can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis and potential applications in drug development or as a biochemical tool may be explored in research settings. Overall, 1-(2-Methylpropyl)-3-pyrrolidineacetic acid represents a compound with intriguing structural features and potential utility in various chemical and biological contexts.

Formula: C₁₀H₁₉NO₂

InChI: InChI=1S/C10H19NO2/c1-8(2)6-11-4-3-9(7-11)5-10(12)13/h8-9H,3-7H2,1-2H3,(H,12,13)

InChI key: InChIKey=INWZNCOPMDMAAP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1CN(CC(C)C)CC1

Synonyms:

• 3-Pyrrolidineacetic acid, 1-(2-methylpropyl)-
• 1-(2-Methylpropyl)-3-pyrrolidineacetic acid