CAS 1220019-67-9

Piperidine, 4-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a chloro-substituted biphenyl moiety, indicating the presence of a chlorine atom attached to one of the phenyl rings, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and its specific interactions can be influenced by the substituents on the biphenyl group. Overall, this compound's unique structure may confer specific pharmacological properties, warranting further investigation for potential therapeutic uses.

Formula: C₁₇H₁₈ClNO·ClH

InChI: InChI=1S/C17H18ClNO.ClH/c18-16-12-14(13-4-2-1-3-5-13)6-7-17(16)20-15-8-10-19-11-9-15;/h1-7,12,15,19H,8-11H2;1H

InChI key: InChIKey=UWJAWOJLHNSNDP-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1OC2CCNCC2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[(3-chloro[1,1′-biphenyl]-4-yl)oxy]-, hydrochloride (1:1)