CAS 1220019-71-5

Piperidine, 4-[2-(2,3-dimethylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(2,3-dimethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a phenoxyethyl side chain that includes a 2,3-dimethylphenyl group, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. The presence of the hydrochloride indicates that the compound is protonated, which can influence its reactivity and biological activity. Piperidine derivatives are often studied for their potential pharmacological applications, including their roles as intermediates in the synthesis of various pharmaceuticals. The specific structure of this compound suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₅H₂₃NO·ClH

InChI: InChI=1S/C15H23NO.ClH/c1-12-4-3-5-15(13(12)2)17-11-8-14-6-9-16-10-7-14;/h3-5,14,16H,6-11H2,1-2H3;1H

InChI key: InChIKey=QQJXFNBOPKLEEK-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=C(C)C(C)=CC=C2.Cl

Synonyms:

• Piperidine, 4-[2-(2,3-dimethylphenoxy)ethyl]-, hydrochloride (1:1)