CAS 1220019-79-3

Piperidine, 3-[2-chloro-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-chloro-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a chloro-substituted phenoxy group, indicating the presence of a chlorine atom and a phenolic moiety that is linked to the piperidine via an ether bond. The presence of the hydrochloride indicates that the compound is in its salt form, which typically enhances its solubility in water and may influence its pharmacological properties. This compound may exhibit biological activity, potentially making it of interest in medicinal chemistry or pharmacology. Its specific interactions, stability, and reactivity would depend on the functional groups present and the overall molecular structure. As with many piperidine derivatives, it may be investigated for its potential applications in drug development or as a chemical intermediate in synthetic processes. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₅H₂₂ClNO·ClH

InChI: InChI=1S/C15H22ClNO.ClH/c1-3-11(2)12-6-7-15(14(16)9-12)18-13-5-4-8-17-10-13;/h6-7,9,11,13,17H,3-5,8,10H2,1-2H3;1H

InChI key: InChIKey=XCFPSMKPPGNZAY-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(C(CC)C)C=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[2-chloro-4-(1-methylpropyl)phenoxy]-, hydrochloride (1:1)