CAS 1220019-81-7

Ethyl 3-amino-4-(3,4-dihydro-1(2H)-quinolinyl)benzoate

Description:

Ethyl 3-amino-4-(3,4-dihydro-1(2H)-quinolinyl)benzoate is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a quinoline moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The quinoline structure is known for its pharmacological significance, often associated with various biological activities, including antimicrobial and antitumor properties. Ethyl 3-amino-4-(3,4-dihydro-1(2H)-quinolinyl)benzoate may also demonstrate moderate lipophilicity due to its hydrophobic aromatic components, which can affect its absorption and distribution in biological systems. As with many organic compounds, its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₈H₂₀N₂O₂

InChI: InChI=1S/C18H20N2O2/c1-2-22-18(21)14-9-10-17(15(19)12-14)20-11-5-7-13-6-3-4-8-16(13)20/h3-4,6,8-10,12H,2,5,7,11,19H2,1H3

InChI key: InChIKey=JTQUVCSVJCWVFS-UHFFFAOYSA-N

SMILES: NC1=C(N2C=3C(CCC2)=CC=CC3)C=CC(C(OCC)=O)=C1

Synonyms:

• Ethyl 3-amino-4-(3,4-dihydro-1(2H)-quinolinyl)benzoate
• Benzoic acid, 3-amino-4-(3,4-dihydro-1(2H)-quinolinyl)-, ethyl ester