CAS 1220019-87-3

1-(5-Bromo-4-methyl-2-pyridinyl)-4-piperidinol

Description:

1-(5-Bromo-4-methyl-2-pyridinyl)-4-piperidinol is a chemical compound characterized by its unique structure, which includes a piperidinol moiety and a pyridine ring substituted with a bromine atom and a methyl group. The presence of the bromine atom contributes to its reactivity and potential biological activity, while the methyl group can influence its lipophilicity and solubility. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in its rings. It may exhibit properties such as being a potential ligand in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The piperidinol part of the molecule can also impart certain pharmacological properties, making it of interest in drug discovery. Overall, the characteristics of this compound suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₅BrN₂O

InChI: InChI=1S/C11H15BrN2O/c1-8-6-11(13-7-10(8)12)14-4-2-9(15)3-5-14/h6-7,9,15H,2-5H2,1H3

InChI key: InChIKey=PKVBEYLGLJGECA-UHFFFAOYSA-N

SMILES: CC=1C=C(N=CC1Br)N2CCC(O)CC2

Synonyms:

• 4-Piperidinol, 1-(5-bromo-4-methyl-2-pyridinyl)-
• 1-(5-Bromo-4-methyl-2-pyridinyl)-4-piperidinol