CymitQuimica logo

CAS 1220019-91-9

:

6-Chloro-N-(3-methylphenyl)-2-pyridinamine

Description:
6-Chloro-N-(3-methylphenyl)-2-pyridinamine is an organic compound characterized by its pyridine and aniline functional groups. It features a chlorine atom at the 6-position of the pyridine ring and a 3-methylphenyl group attached to the nitrogen atom of the amine. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the aromatic and heterocyclic components, which can influence biological activity. The chlorine substituent may also enhance the compound's reactivity and lipophilicity. Additionally, the presence of the methyl group on the phenyl ring can affect the steric and electronic properties, potentially impacting its interaction with biological targets. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C12H11ClN2
InChI:InChI=1S/C12H11ClN2/c1-9-4-2-5-10(8-9)14-12-7-3-6-11(13)15-12/h2-8H,1H3,(H,14,15)
InChI key:InChIKey=UHKRKUTVOLNCHT-UHFFFAOYSA-N
SMILES:N(C1=CC(C)=CC=C1)C=2N=C(Cl)C=CC2
Synonyms:
  • 6-Chloro-N-(3-methylphenyl)-2-pyridinamine
  • 2-Pyridinamine, 6-chloro-N-(3-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.