CAS 1220019-92-0

Piperidine, 4-[[2-chloro-4-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[2-chloro-4-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a chloro-substituted phenoxy group, indicating the presence of a chlorine atom and an isopropyl group attached to a phenolic structure. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The compound's molecular structure contributes to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₅H₂₂ClNO·ClH

InChI: InChI=1S/C15H22ClNO.ClH/c1-11(2)13-3-4-15(14(16)9-13)18-10-12-5-7-17-8-6-12;/h3-4,9,11-12,17H,5-8,10H2,1-2H3;1H

InChI key: InChIKey=XAHTYJGQIJTJSX-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=C(Cl)C=C(C(C)C)C=C2.Cl

Synonyms:

• Piperidine, 4-[[2-chloro-4-(1-methylethyl)phenoxy]methyl]-, hydrochloride (1:1)