CAS 1220020-06-3

3-Piperidinecarboxamide, N-(3-methylphenyl)-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-(3-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the N-(3-methylphenyl) group indicates that a 3-methylphenyl moiety is attached to the nitrogen atom of the piperidinecarboxamide, contributing to its overall hydrophobic character. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its bioavailability in pharmaceutical applications. This compound may exhibit properties such as potential analgesic or anti-inflammatory effects, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with various biological targets, possibly influencing neurotransmitter systems. The CAS number 1220020-06-3 uniquely identifies this compound, facilitating its recognition in chemical databases and literature. As with many piperidine derivatives, it may also be subject to further research for its pharmacological properties and potential therapeutic applications.

Formula: C₁₃H₁₈N₂O·ClH

InChI: InChI=1S/C13H18N2O.ClH/c1-10-4-2-6-12(8-10)15-13(16)11-5-3-7-14-9-11;/h2,4,6,8,11,14H,3,5,7,9H2,1H3,(H,15,16);1H

InChI key: InChIKey=NBHIGVHLSDVFCT-UHFFFAOYSA-N

SMILES: C(NC1=CC(C)=CC=C1)(=O)C2CCCNC2.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-(3-methylphenyl)-, hydrochloride (1:1)