CAS 1220020-10-9

4-(6-Chloro-4-pyrimidinyl)-2-piperazinone

Description:

4-(6-Chloro-4-pyrimidinyl)-2-piperazinone is a chemical compound characterized by its unique structural features, which include a piperazinone moiety and a chlorinated pyrimidine ring. The presence of the chloro group on the pyrimidine enhances its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen atoms in its ring structures. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The piperazinone structure often contributes to the compound's ability to interact with biological targets, such as receptors or enzymes. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its application in pharmaceuticals or agrochemicals. As with many chemical substances, safety and handling precautions are essential, and its potential toxicity and environmental impact should be assessed in accordance with regulatory guidelines.

Formula: C₈H₉ClN₄O

InChI: InChI=1S/C8H9ClN4O/c9-6-3-7(12-5-11-6)13-2-1-10-8(14)4-13/h3,5H,1-2,4H2,(H,10,14)

InChI key: InChIKey=XXJBREJDMMDBCS-UHFFFAOYSA-N

SMILES: ClC1=CC(=NC=N1)N2CC(=O)NCC2

Synonyms:

• 2-Piperazinone, 4-(6-chloro-4-pyrimidinyl)-
• 4-(6-Chloro-4-pyrimidinyl)-2-piperazinone