CAS 1220020-11-0

1,4′-Bipiperidine, 2-ethyl-, hydrochloride (1:2)

Description:

1,4′-Bipiperidine, 2-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its bipiperidine structure, which consists of two piperidine rings connected by a carbon chain. This compound is typically encountered as a hydrochloride salt, indicating that it is protonated and exists in a stable ionic form when dissolved in water. The presence of the ethyl group enhances its lipophilicity, potentially influencing its biological activity and solubility properties. As a derivative of piperidine, it may exhibit properties relevant to medicinal chemistry, including potential applications in pharmaceuticals or as a building block in organic synthesis. The compound's molecular interactions, stability, and reactivity can be influenced by the presence of the hydrochloride moiety, which can affect its behavior in various chemical environments. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, 1,4′-Bipiperidine, 2-ethyl-, hydrochloride (1:2) is of interest in both academic and industrial chemistry contexts.

Formula: C₁₂H₂₄N₂·2ClH

InChI: InChI=1S/C12H24N2.2ClH/c1-2-11-5-3-4-10-14(11)12-6-8-13-9-7-12;;/h11-13H,2-10H2,1H3;2*1H

InChI key: InChIKey=FMPYBYTWZCOWPT-UHFFFAOYSA-N

SMILES: C(C)C1N(CCCC1)C2CCNCC2.Cl

Synonyms:

• 1,4′-Bipiperidine, 2-ethyl-, hydrochloride (1:2)