CAS 1220020-16-5

Piperidine, 4-[[(2,6-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[(2,6-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a 2,6-difluorophenyl group attached via a methoxy methyl linkage contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. The specific arrangement of fluorine atoms on the phenyl ring may influence its lipophilicity and receptor binding affinity. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a class of piperidine derivatives that may have significant implications in drug development and research.

Formula: C₁₃H₁₇F₂NO·ClH

InChI: InChI=1S/C13H17F2NO.ClH/c14-12-2-1-3-13(15)11(12)9-17-8-10-4-6-16-7-5-10;/h1-3,10,16H,4-9H2;1H

InChI key: InChIKey=FFHNQJQOLLPLOT-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)C2=C(F)C=CC=C2F.Cl

Synonyms:

• Piperidine, 4-[[(2,6-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)