CAS 1220020-17-6

1-(6-Chloro-4-pyrimidinyl)-1,2,3,4-tetrahydroquinoline

Description:

1-(6-Chloro-4-pyrimidinyl)-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its unique structure, which combines a tetrahydroquinoline moiety with a pyrimidine ring substituted by a chlorine atom. This compound typically exhibits properties associated with both heterocyclic compounds and nitrogen-containing aromatic systems. The presence of the chloro substituent can influence its reactivity and solubility, potentially enhancing its biological activity. The tetrahydroquinoline structure contributes to its potential as a pharmacophore in medicinal chemistry, often associated with various biological activities, including antitumor and antimicrobial properties. The compound may also exhibit moderate to high lipophilicity, affecting its bioavailability and interaction with biological membranes. Additionally, its molecular weight and specific functional groups can play a significant role in determining its chemical behavior, stability, and potential applications in drug development. Overall, this compound represents a class of heterocyclic compounds that are of interest in pharmaceutical research due to their diverse biological activities.

Formula: C₁₃H₁₂ClN₃

InChI: InChI=1S/C13H12ClN3/c14-12-8-13(16-9-15-12)17-7-3-5-10-4-1-2-6-11(10)17/h1-2,4,6,8-9H,3,5,7H2

InChI key: InChIKey=VBWONGKZZIQGNJ-UHFFFAOYSA-N

SMILES: ClC1=CC(N2C=3C(CCC2)=CC=CC3)=NC=N1

Synonyms:

• 1-(6-Chloro-4-pyrimidinyl)-1,2,3,4-tetrahydroquinoline
• Quinoline, 1-(6-chloro-4-pyrimidinyl)-1,2,3,4-tetrahydro-