CAS 1220020-23-4

Piperidine, 4-[2-[4-(1-methyl-1-phenylethyl)phenoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-[4-(1-methyl-1-phenylethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a phenoxy group and a substituted phenyl moiety, indicating its potential use in medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form suggests enhanced solubility in water, which is often advantageous for biological applications. The presence of the methyl and phenyl groups may contribute to its lipophilicity, influencing its pharmacokinetic properties. As a hydrochloride, it is typically more stable and easier to handle compared to its free base form. The compound's structure suggests potential interactions with biological targets, making it of interest in drug discovery. However, specific biological activity, toxicity, and detailed physicochemical properties would require further investigation through experimental studies and literature review.

Formula: C₂₂H₂₉NO·ClH

InChI: InChI=1S/C22H29NO.ClH/c1-22(2,19-6-4-3-5-7-19)20-8-10-21(11-9-20)24-17-14-18-12-15-23-16-13-18;/h3-11,18,23H,12-17H2,1-2H3;1H

InChI key: InChIKey=LKMQEOMDCHWPTD-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC=C(OCCC2CCNCC2)C=C1)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-[2-[4-(1-methyl-1-phenylethyl)phenoxy]ethyl]-, hydrochloride (1:1)