CAS 1220020-31-4

2-Furancarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)

Description:

2-Furancarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group and an ester linkage, indicating it is derived from 2-furancarboxylic acid. The presence of the piperidinylmethyl group suggests that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the piperidine's role in enhancing bioactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for formulation and delivery in biological systems. The compound's molecular interactions may be influenced by the presence of both the furan and piperidine moieties, potentially affecting its pharmacokinetic properties. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical and pharmaceutical research fields.

Formula: C₁₁H₁₅NO₃·ClH

InChI: InChI=1S/C11H15NO3.ClH/c13-11(10-4-2-6-14-10)15-8-9-3-1-5-12-7-9;/h2,4,6,9,12H,1,3,5,7-8H2;1H

InChI key: InChIKey=CJEPABUXARKPSE-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)(=O)C2=CC=CO2.Cl

Synonyms:

• 2-Furancarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)