CAS 1220020-34-7

1-(6-Chloro-2-pyrazinyl)-2,3-dihydro-1H-indole

Description:

1-(6-Chloro-2-pyrazinyl)-2,3-dihydro-1H-indole is a chemical compound characterized by its unique structural features, which include a dihydroindole core fused with a pyrazine ring substituted with a chlorine atom. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to its ability to interact with various biological targets. The presence of the chloro substituent can influence its reactivity and solubility, while the dihydroindole structure may contribute to its pharmacological properties. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for its practical applications in research and industry. As with many heterocycles, the electronic properties imparted by the nitrogen atoms in the pyrazine ring can also play a significant role in its chemical behavior and interactions.

Formula: C₁₂H₁₀ClN₃

InChI: InChI=1S/C12H10ClN3/c13-11-7-14-8-12(15-11)16-6-5-9-3-1-2-4-10(9)16/h1-4,7-8H,5-6H2

InChI key: InChIKey=YKPZAKYRTAWOBF-UHFFFAOYSA-N

SMILES: ClC=1N=C(N2C=3C(CC2)=CC=CC3)C=NC1

Synonyms:

• 1H-Indole, 1-(6-chloro-2-pyrazinyl)-2,3-dihydro-
• 1-(6-Chloro-2-pyrazinyl)-2,3-dihydro-1H-indole
• 1-(6-Chloropyrazin-2-yl)indoline
• 1-(6-Chloropyrazin-2-yl)-2,3-dihydroindole