CAS 1220020-47-2

Piperidine, 3-[[(3,5-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[(3,5-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 3-[[3,5-difluorophenyl]methoxy]methyl group indicates that it has a difluorophenyl moiety attached via a methoxy linkage, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The difluorophenyl group may impart specific biological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and the presence of fluorine atoms can influence its pharmacokinetic properties, such as metabolic stability and lipophilicity. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the development of therapeutic agents.

Formula: C₁₃H₁₇F₂NO·ClH

InChI: InChI=1S/C13H17F2NO.ClH/c14-12-4-11(5-13(15)6-12)9-17-8-10-2-1-3-16-7-10;/h4-6,10,16H,1-3,7-9H2;1H

InChI key: InChIKey=RRUCDAKLDCWCPV-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=CC(F)=CC(F)=C2.Cl

Synonyms:

• Piperidine, 3-[[(3,5-difluorophenyl)methoxy]methyl]-, hydrochloride (1:1)