CymitQuimica logo

CAS 1220020-51-8

:

5-Bromo-N-(4-methoxyphenyl)-2-pyridinamine

Description:
5-Bromo-N-(4-methoxyphenyl)-2-pyridinamine is an organic compound characterized by its bromine and methoxy functional groups attached to a pyridinamine structure. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for forming coordination complexes. The presence of the bromine atom enhances its reactivity, making it suitable for various substitution reactions. The methoxy group (-OCH3) on the phenyl ring can influence the compound's electronic properties, potentially affecting its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in the synthesis of more complex molecules or as a precursor in pharmaceutical research. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C12H11BrN2O
InChI:InChI=1S/C12H11BrN2O/c1-16-11-5-3-10(4-6-11)15-12-7-2-9(13)8-14-12/h2-8H,1H3,(H,14,15)
InChI key:InChIKey=AHCLHCMULYNNTP-UHFFFAOYSA-N
SMILES:N(C1=CC=C(OC)C=C1)C2=CC=C(Br)C=N2
Synonyms:
  • 5-Bromo-N-(4-methoxyphenyl)-2-pyridinamine
  • 2-Pyridinamine, 5-bromo-N-(4-methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.