
CAS 1220020-55-2
:Acetic acid, 2,2,2-trichloro-, 4-piperidinylmethyl ester, hydrochloride (1:1)
Description:
Acetic acid, 2,2,2-trichloro-, 4-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group and the presence of a piperidine ring, which contributes to its biological activity. The compound features a trichloroacetyl moiety, indicating the presence of three chlorine atoms attached to a carbon atom adjacent to the acetic acid group, enhancing its reactivity and potential for biological interactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can influence its pharmacokinetics and bioavailability. This compound may exhibit properties such as antimicrobial or analgesic effects, making it of interest in pharmaceutical applications. Its structure suggests potential interactions with biological targets, and the presence of the piperidine ring may facilitate binding to specific receptors or enzymes. Safety and handling precautions are essential due to the presence of chlorine, which can pose health risks. Overall, this compound's unique structural features contribute to its potential utility in medicinal chemistry and related fields.
Formula:C8H12Cl3NO2·ClH
InChI:InChI=1S/C8H12Cl3NO2.ClH/c9-8(10,11)7(13)14-5-6-1-3-12-4-2-6;/h6,12H,1-5H2;1H
InChI key:InChIKey=OIGWUSQYZMGMTL-UHFFFAOYSA-N
SMILES:C(OC(C(Cl)(Cl)Cl)=O)C1CCNCC1.Cl
Synonyms:- Acetic acid, 2,2,2-trichloro-, 4-piperidinylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.