CAS 1220020-59-6

Piperidine, 3-[2-(1,1-dimethylethyl)-4-methylphenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(1,1-dimethylethyl)-4-methylphenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a substituent that includes a tert-butyl group and a 4-methylphenoxy moiety, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often found in numerous bioactive compounds. The compound's molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, making it of interest for medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-12-7-8-15(14(10-12)16(2,3)4)18-13-6-5-9-17-11-13;/h7-8,10,13,17H,5-6,9,11H2,1-4H3;1H

InChI key: InChIKey=UDUYUEGZAONRLS-UHFFFAOYSA-N

SMILES: O(C1=C(C(C)(C)C)C=C(C)C=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[2-(1,1-dimethylethyl)-4-methylphenoxy]-, hydrochloride (1:1)