CymitQuimica logo

CAS 1220020-61-0

:

N-(5-Amino-2-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide

Description:
N-(5-Amino-2-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide is a chemical compound characterized by its complex structure, which includes a tetrahydropyran ring and an amine functional group. The presence of a chlorine atom on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the carboxamide group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The amino group may also impart basic properties, making it a potential candidate for interactions with biological targets. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular interactions, stability, and reactivity can be influenced by the substituents on the aromatic ring and the cyclic structure, making it a subject of interest for further research in drug design and synthesis. Overall, N-(5-Amino-2-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide represents a versatile scaffold for exploring therapeutic agents.
Formula:C12H15ClN2O2
InChI:InChI=1S/C12H15ClN2O2/c13-10-2-1-9(14)7-11(10)15-12(16)8-3-5-17-6-4-8/h1-2,7-8H,3-6,14H2,(H,15,16)
InChI key:InChIKey=YTBFCANHBMHZJA-UHFFFAOYSA-N
SMILES:N(C(=O)C1CCOCC1)C2=C(Cl)C=CC(N)=C2
Synonyms:
  • 2H-Pyran-4-carboxamide, N-(5-amino-2-chlorophenyl)tetrahydro-
  • N-(5-Amino-2-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.