CAS 1220020-63-2

N-Methyl-N-(2,2,2-trichloroacetyl)glycine

Description:

N-Methyl-N-(2,2,2-trichloroacetyl)glycine is a synthetic compound characterized by its unique structure, which includes a glycine backbone modified with a methyl group and a trichloroacetyl moiety. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The presence of the trichloroacetyl group imparts significant reactivity, particularly in nucleophilic substitution reactions, making it useful in various chemical syntheses. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the trichloroacetyl group is known for its ability to enhance lipophilicity, which can influence the bioavailability and pharmacokinetics of related compounds. Safety considerations are important, as the trichloroacetyl moiety can be toxic and may pose environmental hazards. Therefore, handling this substance requires appropriate safety measures to mitigate risks associated with exposure. Overall, N-Methyl-N-(2,2,2-trichloroacetyl)glycine is a compound of interest in both research and industrial applications due to its distinctive chemical properties.

Formula: C₅H₆Cl₃NO₃

InChI: InChI=1S/C5H6Cl3NO3/c1-9(2-3(10)11)4(12)5(6,7)8/h2H2,1H3,(H,10,11)

InChI key: InChIKey=FNELUBQIJXOFCS-UHFFFAOYSA-N

SMILES: N(C(C(Cl)(Cl)Cl)=O)(CC(O)=O)C

Synonyms:

• Glycine, N-methyl-N-(2,2,2-trichloroacetyl)-
• N-Methyl-N-(2,2,2-trichloroacetyl)glycine