CymitQuimica logo

CAS 1220020-72-3

:

N-(3-Amino-4-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide

Description:
N-(3-Amino-4-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide is a chemical compound characterized by its unique structural features, including a tetrahydropyran ring and an amide functional group. The presence of a 3-amino-4-chlorophenyl moiety contributes to its potential biological activity, as aromatic amines often play significant roles in medicinal chemistry. This compound may exhibit properties such as solubility in polar solvents, depending on the specific functional groups and their interactions. The tetrahydropyran ring can influence the compound's conformation and reactivity, potentially affecting its pharmacokinetic and pharmacodynamic profiles. Additionally, the chlorinated aromatic ring may enhance lipophilicity, which can impact membrane permeability and bioavailability. Overall, the characteristics of this compound suggest it could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies and literature review.
Formula:C12H15ClN2O2
InChI:InChI=1S/C12H15ClN2O2/c13-10-2-1-9(7-11(10)14)15-12(16)8-3-5-17-6-4-8/h1-2,7-8H,3-6,14H2,(H,15,16)
InChI key:InChIKey=ZXPQMZJGEVIMCT-UHFFFAOYSA-N
SMILES:N(C(=O)C1CCOCC1)C2=CC(N)=C(Cl)C=C2
Synonyms:
  • N-(3-Amino-4-chlorophenyl)tetrahydro-2H-pyran-4-carboxamide
  • 2H-Pyran-4-carboxamide, N-(3-amino-4-chlorophenyl)tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.