
CAS 1220020-78-9
:Piperidine, 3-(2-bromo-4-chloro-3,5-dimethylphenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 3-(2-bromo-4-chloro-3,5-dimethylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 2-bromo-4-chloro-3,5-dimethylphenoxy group indicates that it has significant substituents that can influence its reactivity and biological activity. The hydrochloride form suggests that the compound is a salt, which typically enhances its solubility in water and may affect its stability and handling properties. This compound may exhibit pharmacological properties due to the piperidine structure, which is often found in various bioactive molecules. Its specific interactions and applications would depend on the functional groups present and their spatial arrangement. As with many halogenated compounds, it may also exhibit unique reactivity patterns, making it of interest in medicinal chemistry and material science. Safety data and handling precautions should be consulted, as halogenated compounds can pose environmental and health risks.
Formula:C13H17BrClNO·ClH
InChI:InChI=1S/C13H17BrClNO.ClH/c1-8-6-11(12(14)9(2)13(8)15)17-10-4-3-5-16-7-10;/h6,10,16H,3-5,7H2,1-2H3;1H
InChI key:InChIKey=UYKHBCMVXSPWCX-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C(C)=C(Cl)C(C)=C1)C2CCCNC2.Cl
Synonyms:- Piperidine, 3-(2-bromo-4-chloro-3,5-dimethylphenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.