
CAS 1220020-81-4
:4-Pyridinecarboxylic acid, 3-pyrrolidinylmethyl ester, hydrochloride (1:1)
Description:
4-Pyridinecarboxylic acid, 3-pyrrolidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyridine and pyrrolidine moieties, which contribute to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. The presence of the pyridine ring imparts basicity, while the carboxylic acid group can participate in hydrogen bonding and influence the compound's reactivity. The pyrrolidine ring adds to the compound's structural complexity and may affect its pharmacological profile. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Its molecular structure suggests it may exhibit specific interactions with biological targets, making it a subject of interest in drug design and synthesis. As with many chemical substances, handling should be done with care, adhering to safety protocols due to potential toxicity or reactivity.
Formula:C11H14N2O2·ClH
InChI:InChI=1S/C11H14N2O2.ClH/c14-11(10-2-5-12-6-3-10)15-8-9-1-4-13-7-9;/h2-3,5-6,9,13H,1,4,7-8H2;1H
InChI key:InChIKey=LRNXEOYGJWWCHJ-UHFFFAOYSA-N
SMILES:C(OCC1CCNC1)(=O)C=2C=CN=CC2.Cl
Synonyms:- 4-Pyridinecarboxylic acid, 3-pyrrolidinylmethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.