CymitQuimica logo

CAS 1220020-88-1

:

Benzoic acid, 4-(3-piperidinyloxy)-, ethyl ester, hydrochloride (1:1)

Description:
Benzoic acid, 4-(3-piperidinyloxy)-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzoic acid moiety, a piperidine ring, and an ethyl ester functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The piperidinyloxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its hydrochloride form enhances solubility and stability, which is advantageous for formulation in various applications. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity. Proper storage conditions are essential to maintain its integrity and efficacy.
Formula:C14H19NO3·ClH
InChI:InChI=1S/C14H19NO3.ClH/c1-2-17-14(16)11-5-7-12(8-6-11)18-13-4-3-9-15-10-13;/h5-8,13,15H,2-4,9-10H2,1H3;1H
InChI key:InChIKey=DNWRXNXLTAIICV-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(OCC)=O)C=C1)C2CCCNC2.Cl
Synonyms:
  • Benzoic acid, 4-(3-piperidinyloxy)-, ethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.