
CAS 1220021-02-2
:Benzoic acid, 4-methoxy-, 4-piperidinyl ester, hydrochloride (1:1)
Description:
Benzoic acid, 4-methoxy-, 4-piperidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group, which is formed from benzoic acid and a piperidine derivative. This compound typically exhibits properties associated with both benzoic acid and piperidine, including potential solubility in polar solvents due to the presence of the hydrochloride salt form. The methoxy group contributes to its overall polarity and can influence its reactivity and interaction with biological systems. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous environments compared to its free base form. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperidine moiety, which is often found in various bioactive compounds. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values.
Formula:C13H17NO3·ClH
InChI:InChI=1S/C13H17NO3.ClH/c1-16-11-4-2-10(3-5-11)13(15)17-12-6-8-14-9-7-12;/h2-5,12,14H,6-9H2,1H3;1H
InChI key:InChIKey=IYZHGTONULZESK-UHFFFAOYSA-N
SMILES:C(OC1CCNCC1)(=O)C2=CC=C(OC)C=C2.Cl
Synonyms:- Benzoic acid, 4-methoxy-, 4-piperidinyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.