CAS 1220021-05-5

Cyclopentanecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Cyclopentanecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and a piperidine moiety. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the piperidinylmethyl ester group suggests potential biological activity, as piperidine derivatives are often associated with various pharmacological properties. The hydrochloride form indicates that the compound is a salt, which can influence its stability and bioavailability. In terms of reactivity, the carboxylic acid functionality can participate in various chemical reactions, such as esterification and amidation. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential applications in therapeutic contexts. However, specific safety and handling guidelines should be followed, as with all chemical substances.

Formula: C₁₂H₂₁NO₂·ClH

InChI: InChI=1S/C12H21NO2.ClH/c14-12(11-5-1-2-6-11)15-9-10-4-3-7-13-8-10;/h10-11,13H,1-9H2;1H

InChI key: InChIKey=VNGABKUBOAJAII-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)(=O)C2CCCC2.Cl

Synonyms:

• Cyclopentanecarboxylic acid, 3-piperidinylmethyl ester, hydrochloride (1:1)