CAS 1220021-08-8

3-Azetidinyl 4-methoxybenzoate

Description:

3-Azetidinyl 4-methoxybenzoate is a chemical compound characterized by its unique structural features, which include an azetidine ring and a methoxy-substituted benzoate moiety. The azetidine ring, a four-membered nitrogen-containing heterocycle, contributes to the compound's potential biological activity and reactivity. The presence of the methoxy group on the benzoate enhances its lipophilicity, which can influence its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and potential for synthesis are influenced by the functional groups present, making it a candidate for further research in drug development and chemical synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1S/C11H13NO3/c1-14-9-4-2-8(3-5-9)11(13)15-10-6-12-7-10/h2-5,10,12H,6-7H2,1H3

InChI key: InChIKey=ATJHAYWYNJJBKK-UHFFFAOYSA-N

SMILES: C(OC1CNC1)(=O)C2=CC=C(OC)C=C2

Synonyms:

• Benzoic acid, 4-methoxy-, 3-azetidinyl ester
• 3-Azetidinyl 4-methoxybenzoate