CAS 1220021-11-3

3-Azetidinyl tetrahydro-2H-pyran-4-carboxylate

Description:

3-Azetidinyl tetrahydro-2H-pyran-4-carboxylate is a chemical compound characterized by its unique bicyclic structure, which includes an azetidine ring and a tetrahydro-pyran moiety. The azetidine ring contributes to its potential as a building block in organic synthesis and medicinal chemistry, while the tetrahydro-pyran structure enhances its stability and solubility in various solvents. The carboxylate functional group indicates that the compound can participate in various chemical reactions, including esterification and nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of substituents. As with many organic compounds, safety and handling precautions should be observed due to potential reactivity and toxicity. Overall, 3-Azetidinyl tetrahydro-2H-pyran-4-carboxylate represents a versatile structure in the realm of organic chemistry.

Formula: C₉H₁₅NO₃

InChI: InChI=1S/C9H15NO3/c11-9(13-8-5-10-6-8)7-1-3-12-4-2-7/h7-8,10H,1-6H2

InChI key: InChIKey=QUVNLFYFLNEGRT-UHFFFAOYSA-N

SMILES: C(OC1CNC1)(=O)C2CCOCC2

Synonyms:

• 3-Azetidinyl tetrahydro-2H-pyran-4-carboxylate
• 2H-Pyran-4-carboxylic acid, tetrahydro-, 3-azetidinyl ester