CymitQuimica logo

CAS 1220021-14-6

:

N1-Methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine

Description:
N1-Methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two amino groups and a methyl group, along with a tetrahydro-2H-pyran moiety. This compound features a tetrahydropyran ring, which contributes to its cyclic structure and may influence its reactivity and solubility. The presence of the amino groups suggests potential for hydrogen bonding and reactivity in various chemical environments, making it of interest in medicinal chemistry and organic synthesis. The methylation at the nitrogen atom can affect the compound's basicity and steric properties. Additionally, the compound's molecular weight, solubility in organic solvents, and stability under various conditions would be important characteristics to consider for practical applications. Overall, this compound's unique structural features may lend it specific biological activities or functionalities, warranting further investigation in research and development contexts.
Formula:C13H20N2O
InChI:InChI=1S/C13H20N2O/c1-15(10-11-6-8-16-9-7-11)13-5-3-2-4-12(13)14/h2-5,11H,6-10,14H2,1H3
InChI key:InChIKey=LLAWRHYEOFIFTB-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(N)C=CC=C2
Synonyms:
  • N1-Methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine
  • 1,2-Benzenediamine, N1-methyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.