
CAS 1220021-15-7
:4-Piperidineethanol, 4-benzoate, hydrochloride (1:1)
Description:
4-Piperidineethanol, 4-benzoate, hydrochloride (1:1) is a chemical compound characterized by its piperidine and ethanol functional groups, along with a benzoate moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar nature due to the presence of the hydroxyl group and the hydrochloride salt form. The piperidine ring contributes to its basicity, while the benzoate group may influence its pharmacological properties, potentially making it relevant in medicinal chemistry. The hydrochloride salt form enhances its stability and solubility, which is advantageous for various applications, including drug formulation. As with many piperidine derivatives, it may exhibit biological activity, making it of interest in research related to neuropharmacology or other therapeutic areas. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H19NO2·ClH
InChI:InChI=1S/C14H19NO2.ClH/c16-14(13-4-2-1-3-5-13)17-11-8-12-6-9-15-10-7-12;/h1-5,12,15H,6-11H2;1H
InChI key:InChIKey=XNHSGGUDRHUZLD-UHFFFAOYSA-N
SMILES:C(OCCC1CCNCC1)(=O)C2=CC=CC=C2.Cl
Synonyms:- 4-Piperidineethanol, 4-benzoate, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.