CAS 1220021-16-8

Benzoic acid, 4-methoxy-, 3-pyrrolidinyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 4-methoxy-, 3-pyrrolidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its ester functional group, which is formed from benzoic acid and a pyrrolidine derivative. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The methoxy group enhances its lipophilicity, potentially influencing its biological activity. The pyrrolidine moiety may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The hydrochloride form indicates that the compound is a salt, which can affect its stability and solubility profile. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols, as it may exhibit irritant properties. Its specific applications and effects would depend on further studies, particularly in the context of its interactions within biological systems.

Formula: C₁₂H₁₅NO₃·ClH

InChI: InChI=1S/C12H15NO3.ClH/c1-15-10-4-2-9(3-5-10)12(14)16-11-6-7-13-8-11;/h2-5,11,13H,6-8H2,1H3;1H

InChI key: InChIKey=ZLRRTIJSRDJHDD-UHFFFAOYSA-N

SMILES: C(OC1CCNC1)(=O)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Benzoic acid, 4-methoxy-, 3-pyrrolidinyl ester, hydrochloride (1:1)