
CAS 1220021-19-1
:3-Pyrrolidinemethanamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)
Description:
3-Pyrrolidinemethanamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups and a pyrrolidine ring structure. It is a hydrochloride salt, which indicates that it is soluble in water and typically exhibits a crystalline form. The presence of cyclohexyl and methyl groups contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit basic properties due to the amine groups, allowing it to participate in protonation reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with various biological targets. Additionally, the compound's stability and reactivity can be influenced by the presence of the hydrochloride moiety, which can enhance its shelf-life and usability in various chemical reactions. As with many amines, it may also exhibit properties such as being a potential neurotransmitter or modulator, although specific biological activities would require further investigation.
Formula:C12H24N2·2ClH
InChI:InChI=1S/C12H24N2.2ClH/c1-14(10-11-7-8-13-9-11)12-5-3-2-4-6-12;;/h11-13H,2-10H2,1H3;2*1H
InChI key:InChIKey=PGYWVINVZVPMOI-UHFFFAOYSA-N
SMILES:N(CC1CCNC1)(C)C2CCCCC2.Cl
Synonyms:- 3-Pyrrolidinemethanamine, N-cyclohexyl-N-methyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.