
CAS 1220021-22-6
:3-Chloro-N2-methyl-N2-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine
Description:
3-Chloro-N2-methyl-N2-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine is a chemical compound characterized by its complex structure, which includes a chloro substituent and a tetrahydro-pyran moiety. This compound features a benzene ring with two amino groups (1,2-benzenediamine) and a methyl group attached to one of the nitrogen atoms, contributing to its potential reactivity and solubility properties. The presence of the tetrahydro-2H-pyran group suggests that it may exhibit unique steric and electronic properties, influencing its interactions in biological systems or chemical reactions. The chloro group can serve as a site for further substitution reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the presence of multiple functional groups may impart specific biological activities, making it of interest in medicinal chemistry. Overall, the compound's characteristics, including its molecular weight, solubility, and reactivity, would be essential for understanding its applications and behavior in various chemical contexts.
Formula:C13H19ClN2O
InChI:InChI=1S/C13H19ClN2O/c1-16(9-10-5-7-17-8-6-10)13-11(14)3-2-4-12(13)15/h2-4,10H,5-9,15H2,1H3
InChI key:InChIKey=BDODEELYNQSNQT-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(Cl)C=CC=C2N
Synonyms:- 3-Chloro-N2-methyl-N2-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine
- 1,2-Benzenediamine, 3-chloro-N2-methyl-N2-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.