CAS 1220021-25-9

3-(Cyclobutylmethyl)pyrrolidine

Description:

3-(Cyclobutylmethyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a cyclobutylmethyl group. This compound features a five-membered nitrogen-containing heterocycle, which contributes to its potential biological activity and chemical reactivity. The cyclobutylmethyl substituent introduces a degree of steric hindrance and may influence the compound's interactions with biological targets, making it of interest in medicinal chemistry. The presence of the nitrogen atom in the pyrrolidine ring can also impart basic properties, allowing for potential interactions with acids and other electrophiles. Additionally, the compound's molecular geometry and functional groups may affect its solubility, stability, and overall reactivity. As with many nitrogen-containing heterocycles, 3-(Cyclobutylmethyl)pyrrolidine may exhibit interesting pharmacological properties, warranting further investigation in drug development and synthesis. Its specific applications and behavior in various chemical environments would depend on additional factors such as temperature, solvent, and the presence of other reactive species.

Formula: C₉H₁₇N

InChI: InChI=1S/C9H17N/c1-2-8(3-1)6-9-4-5-10-7-9/h8-10H,1-7H2

InChI key: InChIKey=DTYXLIYJPAQKGO-UHFFFAOYSA-N

SMILES: C(C1CCC1)C2CCNC2

Synonyms:

• 3-(Cyclobutylmethyl)pyrrolidine
• Pyrrolidine, 3-(cyclobutylmethyl)-