CAS 1220021-30-6

Methanone, (2,3-dihydro-1H-indol-1-yl)-4-piperidinyl-, hydrochloride (1:1)

Description:

Methanone, (2,3-dihydro-1H-indol-1-yl)-4-piperidinyl-, hydrochloride (1:1), with CAS number 1220021-30-6, is a chemical compound characterized by its complex structure that includes an indole moiety and a piperidine ring. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceutical contexts. The presence of the indole structure suggests potential biological activity, as indole derivatives are often associated with neurotransmitter modulation and other pharmacological effects. The piperidine component may contribute to its ability to interact with biological targets, potentially influencing its efficacy and safety profile. As a hydrochloride salt, it is likely to exhibit improved stability and bioavailability compared to its free base form. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological or psychiatric conditions.

Formula: C₁₄H₁₈N₂O·ClH

InChI: InChI=1S/C14H18N2O.ClH/c17-14(12-5-8-15-9-6-12)16-10-7-11-3-1-2-4-13(11)16;/h1-4,12,15H,5-10H2;1H

InChI key: InChIKey=OZBSDSDTUCLUMZ-UHFFFAOYSA-N

SMILES: C(=O)(N1C=2C(CC1)=CC=CC2)C3CCNCC3.Cl

Synonyms:

• Methanone, (2,3-dihydro-1H-indol-1-yl)-4-piperidinyl-, hydrochloride (1:1)

2,3-Dihydro-1H-indol-1-yl(4-piperidinyl)methanone

CAS: 1220021-30-6

Versatile small molecule scaffold

Formula: C₁₄H₁₉ClN₂O

Purity: Min. 95%

Molecular weight: 266.76 g/mol

Ref: 3D-VYB02130