
CAS 1220021-35-1
:3-Pyrrolidinol, 1-(2-piperidinylmethyl)-, hydrochloride (1:2)
Description:
3-Pyrrolidinol, 1-(2-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a piperidine moiety. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical and chemical research. The compound exhibits basic properties due to the presence of nitrogen atoms in its cyclic structures, which can participate in hydrogen bonding and contribute to its reactivity. It may also display biological activity, potentially influencing neurotransmitter systems or other physiological pathways, although specific pharmacological effects would depend on further studies. The compound's molecular interactions, stability, and potential applications in drug development or synthesis processes are areas of interest for researchers. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C10H20N2O·2ClH
InChI:InChI=1S/C10H20N2O.2ClH/c13-10-4-6-12(8-10)7-9-3-1-2-5-11-9;;/h9-11,13H,1-8H2;2*1H
InChI key:InChIKey=UHXQEBFRSGXNPI-UHFFFAOYSA-N
SMILES:C(N1CCC(O)C1)C2CCCCN2.Cl
Synonyms:- 3-Pyrrolidinol, 1-(2-piperidinylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.